Question

C-Co2-Cu(OH)2-CuSo4-Cu3(Po4)2

Answer 1

C-CO2-Cu(OH)2-CuSo4-Cu3(Po4)2
C + O2 = CO2

Cu(OH)2 + H2SO4 = CuSO4 +2 H2O

3CuSO4 + 2H3PO4 = Cu3(PO4)2 + 3H2SO4

Answer 2

The sequence of chemical compounds you've provided appears to be a list of chemical formulas. Let me break down what each of these compounds is:

1. C: This usually represents carbon. Carbon is a fundamental element in organic chemistry and is present in a wide range of compounds.

2. CO2: This is carbon dioxide, a common gas in the Earth's atmosphere. It's composed of one carbon atom (C) bonded to two oxygen atoms (O).

3. Cu(OH)2: This is copper(II) hydroxide. It consists of a copper (Cu) atom bonded to two hydroxide (OH-) ions.

4. CuSO4: This is copper(II) sulfate. It consists of a copper (Cu) atom bonded to a sulfate (SO4^2-) ion.

5. Cu3(PO4)2: This is copper(II) phosphate. It consists of three copper (Cu) atoms bonded to two phosphate (PO4^3-) ions.

If you have any specific questions about these compounds or if you'd like more information about their properties or reactions, please feel free to ask.