Question

Ba(OH)2+HNO3=Ba(No3)2+2H2O

Answer 1

П - полная форма

С - сокращенная форма

Answer 2

The given chemical equation represents a neutralization reaction between barium hydroxide (Ba(OH)2) and nitric acid (HNO3) to form barium nitrate (Ba(NO3)2) and water (H2O). The balanced chemical equation is as follows:

Ba(OH)2 + 2HNO3 → Ba(NO3)2 + 2H2O

In this reaction, barium hydroxide (Ba(OH)2) reacts with two molecules of nitric acid (HNO3) to produce barium nitrate (Ba(NO3)2) and two molecules of water (H2O). Note that the coefficients in front of each compound represent the stoichiometric coefficients, ensuring that the number of atoms of each element remains balanced on both sides of the equation.