Question

N2-NH3-NO2-HNO3-Cu(NO3)2

Answer 1

N2+3H2=2NH3

4NH3 +7O2 =4NO2 + 6H2O

2NO2+H2O=HNO3+HNO2

Cu(OH)2+HNO3=Cu(NO3)2+2H2O

Answer 2

The sequence you provided appears to be a combination of chemical symbols and formulas representing a series of chemical reactions involving different compounds. Let's break it down step by step:

1. N2: This represents a molecule of nitrogen gas (N2), which is a diatomic molecule commonly found in the atmosphere.

2. NH3: This represents ammonia, a compound composed of one nitrogen atom and three hydrogen atoms (NH3). It is a common gas with a pungent smell and is used in various industrial and household applications.

3. NO2: This represents nitrogen dioxide, a reddish-brown gas composed of one nitrogen atom and two oxygen atoms (NO2). It is a harmful air pollutant and one of the nitrogen oxides formed during combustion processes.

4. HNO3: This represents nitric acid, a strong mineral acid composed of one nitrogen atom, one hydrogen atom, and three oxygen atoms (HNO3). It is a highly corrosive and reactive acid used in the production of fertilizers, explosives, and various chemical processes.

5. Cu(NO3)2: This represents copper(II) nitrate, a chemical compound composed of one copper ion (Cu^2+) and two nitrate ions (NO3^-). It is a blue crystalline solid and is used in various chemical processes and as a source of copper in certain applications.

Without further context or information, it's challenging to understand the exact meaning or purpose of this sequence. It appears to depict a series of chemical reactions or the presence of different chemical species. If you have a specific question or need clarification on any part of this sequence, please feel free to ask!