Question

SO4=ZnSO4=Zn(OH)2=ZnO=SO4

Answer 1

Ответ:

Объяснение:

H2SO4 + Zn -> ZnSO4 + H2↑

ZnSO4 + 2NaOH -> Zn(OH)2↓ + Na2SO4

Zn(OH)2 -> ZnO + H2O

ZnO + H2SO4 = ZnSO4 + H2O

Answer 2

The chemical equations you provided involve various compounds containing zinc (Zn) and sulfate (SO4) ions. However, the equations are not entirely accurate. Let's break down each equation and correct them:

1. SO4: This formula represents the sulfate ion (SO4²⁻), which is a polyatomic ion consisting of one sulfur atom bonded to four oxygen atoms. It is not a compound but an ion commonly found in many chemical compounds.

2. ZnSO4: This formula represents zinc sulfate, which is a compound formed by the combination of zinc (Zn²⁺) ions and sulfate (SO4²⁻) ions. Zinc sulfate has the formula ZnSO4 and is commonly used in various industrial and agricultural applications.

3. Zn(OH)2: This formula represents zinc hydroxide, which is a compound composed of zinc (Zn²⁺) ions and hydroxide (OH⁻) ions. Zinc hydroxide has the formula Zn(OH)2 and is a white, insoluble solid.

4. ZnO: This formula represents zinc oxide, which is a compound consisting of zinc (Zn²⁺) ions and oxygen (O²⁻) ions. Zinc oxide has the formula ZnO and is a white powder commonly used in various applications, including as a pigment in paints, sunscreen, and pharmaceuticals.

It's important to note that these compounds are distinct and have different chemical properties and applications. While they may contain similar elements, they cannot be equated directly.