Question

N2-N2O5-HNO3-Cu(NO3)2-Cu(OH)2

Answer 1

Ответ:

Объяснение:

2N2 + 5O2 = 2N2O5

N2O5 + H2O = 2HNO3

2HNO3 + CuO = Cu(NO3)2 + H2O

Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3

Answer 2

The series of chemical compounds you provided appears to be related to a chemical reaction or a sequence of reactions. Let's break it down step by step:

1. N2 (Nitrogen gas)
2. N2O5 (Dinitrogen pentoxide)
3. HNO3 (Nitric acid)
4. Cu(NO3)2 (Copper(II) nitrate)
5. Cu(OH)2 (Copper(II) hydroxide)

The possible reactions involving these compounds could be:

1. Formation of Nitric Acid (HNO3): N2O5 + H2O → 2 HNO3

2. Reaction of Nitric Acid with Copper(II) Hydroxide: 2 HNO3 + Cu(OH)2 → Cu(NO3)2 + 2 H2O

In this reaction, nitric acid reacts with copper(II) hydroxide to produce copper(II) nitrate and water.

Please note that these reactions are just examples, and there might be other reactions or scenarios involving the given compounds depending on the specific context or experimental conditions. If you have a particular question or context in mind, feel free to provide more details, and I'll be happy to assist you further.