Question

NH3=NH4Cl=(NH4)2SO4=NH4OH=NH3

Answer 1

NH3 + HCl = NH4Cl;

NH4Cl + NaOH = NH3 + H2O + NaCl;

NH3 + H2O = NH4OH.

NH4OH = NH3 +t H20

Answer 2

The chemical equation you've provided is not balanced, and it seems to represent multiple reactions. Let me try to clarify each part:

1. NH3 (Ammonia): This is the chemical formula for ammonia, a colorless gas with a pungent smell. It is a common gas used in various industrial and laboratory processes.

2. NH4Cl (Ammonium chloride): This is the chemical formula for ammonium chloride, a white crystalline salt. When ammonia gas (NH3) reacts with hydrochloric acid (HCl), it forms ammonium chloride (NH4Cl).

3. (NH4)2SO4 (Ammonium sulfate): This is the chemical formula for ammonium sulfate, a white crystalline salt. It is formed when ammonia (NH3) reacts with sulfuric acid (H2SO4).

4. NH4OH (Ammonium hydroxide): This formula is often used to represent a solution of ammonia (NH3) dissolved in water, forming ammonium hydroxide (NH4OH). However, it is essential to note that pure ammonium hydroxide does not exist as a stable compound.

In summary, the relationship between these chemicals is as follows:

NH3 (Ammonia) reacts with HCl (Hydrochloric acid) to form NH4Cl (Ammonium chloride). NH3 (Ammonia) reacts with H2SO4 (Sulfuric acid) to form (NH4)2SO4 (Ammonium sulfate). NH3 (Ammonia) dissolved in water can be represented as NH4OH (Ammonium hydroxide), but it is a simplified notation and not an actual chemical species.

It is essential to balance chemical equations and represent accurate reactions when dealing with chemical processes.