Question

C1.Гидроксид меди (II) реагирует с: а)H2O б)HNO3 в)Al2O3 г)Au

Answer 1

Ответ:

б

Объяснение: гидроксид меди - основание. Характерна реакции нейтрализации(кислота+основание)

Cu(OH)2+2HNO3=2Cu(NO3)2+2H2O

Answer 2

Ответ: б)

Объяснение:

Cu(OH)₂ - основной гидроксид, поэтому будет взаимодействовать с кислотой HNO₃

Сu(OH)₂ + 2HNO₃=Cu(NO₃)₂ + 2H₂O

Answer 3

Copper(II) hydroxide (Cu(OH)2) can react with the following substances:

а) H2O (water): Copper(II) hydroxide can undergo a reaction with water to form copper(II) oxide (CuO) and water: Cu(OH)2 + H2O → CuO + H2O

б) HNO3 (nitric acid): Copper(II) hydroxide reacts with nitric acid to produce copper(II) nitrate [Cu(NO3)2], water, and nitrogen dioxide (NO2) gas: Cu(OH)2 + 2 HNO3 → Cu(NO3)2 + 2 H2O + NO2

в) Al2O3 (aluminum oxide): Copper(II) hydroxide doesn't typically react with aluminum oxide under normal conditions. This reaction would not be a common or expected one.

г) Au (gold): Copper(II) hydroxide doesn't readily react with gold under normal conditions. These two substances would likely not react with each other.

Please note that these reactions are based on general chemical knowledge, and the specific reaction conditions (such as temperature, concentration, and presence of catalysts) can influence the outcomes. Always verify with reliable sources and conduct experiments under controlled conditions for precise results.