Question

CH3-Ch(ch3)-c=c-ch(ch3)-ch3​

Answer 1

CH3-CH(CH3)-C(CH3)-CH3 2,2,3-триметилбутан

Answer 2

The chemical structure you've provided appears to be a simplified representation of a molecule. It looks like you're trying to draw a molecule using a text-based format. Here's the structure you've written with the atoms labeled for clarity:

mathematicaCopy code
   H
   |
CH3-C-CH3
   |  |
   C=C
  /   \
 CH3  CH3

This structure seems to depict a hydrocarbon molecule. The molecule consists of three carbon atoms, each bonded to hydrogen atoms. The central carbon atom forms a double bond with one of the neighboring carbon atoms, while the other carbon atom is bonded to two methyl (CH3) groups.

If you have any specific questions about this molecule or if you need more information about it, please feel free to ask.