Вопрос задан 16.06.2023 в 07:41. Предмет Химия. Спрашивает Наливайко Анатолий.

N2-nh3-no-no2-hno3-cu(no3)2-cu(oh)2

0 0
Перейти к ответам

Ответы на вопрос

Внимание! Ответы на вопросы дают живые люди. Они могут содержать ошибочную информацию, заблуждения, а также ответы могут быть сгенерированы нейросетями. Будьте внимательны. Если вы уверены, что ответ неверный, нажмите кнопку "Пожаловаться" под ответом.
Отвечает Абдиразак Назерке.

Объяснение:

Это алгебра?

Какой класс

Потом отвечу

0 0
Отвечает нейросеть ChatGpt. Будьте внимательны, ответы нейросети могут содержать ошибочные или выдуманные данные.

N2 - This is the chemical formula for nitrogen gas, which is a diatomic molecule consisting of two nitrogen atoms bonded together.

NH3 - This is the chemical formula for ammonia, which is a compound made up of one nitrogen atom bonded to three hydrogen atoms.

NO - This is the chemical formula for nitric oxide, a colorless gas with a sharp odor.

NO2 - This is the chemical formula for nitrogen dioxide, a reddish-brown gas with a sharp, acrid odor.

HNO3 - This is the chemical formula for nitric acid, a highly corrosive and toxic strong mineral acid.

Cu(NO3)2 - This is the chemical formula for copper(II) nitrate, a blue crystalline solid that is commonly used in the preparation of copper catalysts and as a mordant in dyeing and printing textiles.

Cu(OH)2 - This is the chemical formula for copper(II) hydroxide, a pale blue solid that is sparingly soluble in water.

The given chemical formulas represent a variety of nitrogen and copper compounds, each with its own unique properties and uses. If you have specific questions about any of these compounds, feel free to ask!

0 0

Похожие вопросы

Топ вопросов за вчера в категории Химия

Химия 8 Энконов Артём

Последние заданные вопросы в категории Химия

Задать вопрос