Question

1)Co-Co(NO3)2-CoOHNO3-Co(OH)2-K2[Co(OH)4]2) No-NiSO4-Ni(OH)2-Ni(OH)3-NiCl2​

Answer 1

1) co + hno3 = Co(NO3)2 + 2 NO2 + 2 H2O
Co (no3)2 + naoh = coohno3 ( nano3
Coohno3 + naoh = co(oh)2 + nano3
Co(oh)2 + 2koh= K2[co(oh)4]
2)
Ni + h2so4 = niso4 + H2
Niso4 + 2naoh = Ni(oh)2 + na2so4
2Ni(oh)2 + h2o2 = 2Ni(oh)3
2Ni(oh)3 + 6hcl = 2nicl2 + 6h2o + cl2
Никель не образует тригалогенидов, поэтому так

Answer 2

It looks like you've provided two sets of chemical reactions. Let's break them down step by step:

1. Co-Co(NO3)2-CoOHNO3-Co(OH)2-K2[Co(OH)4]2

The given reactions involve the transformation of cobalt (Co) compounds. Here's how each step unfolds:

a) Co(NO3)2: Cobalt nitrate b) CoOHNO3: Cobalt nitrate undergoes a reaction to form cobalt hydroxide nitrate. c) Co(OH)2: Cobalt hydroxide nitrate decomposes to produce cobalt hydroxide. d) K2[Co(OH)4]2: Cobalt hydroxide reacts with potassium hydroxide to form the complex compound potassium cobalt hydroxide.

2. No-NiSO4-Ni(OH)2-Ni(OH)3-NiCl2

The given reactions involve the transformation of nickel (Ni) compounds. Here's the breakdown:

a) NiSO4: Nickel sulfate b) Ni(OH)2: Nickel sulfate reacts with a base (such as sodium hydroxide) to form nickel hydroxide. c) Ni(OH)3: Nickel hydroxide further reacts with a base to form nickel hydroxide (oxidation state +3). d) NiCl2: Nickel hydroxide (oxidation state +3) undergoes a reaction with hydrochloric acid to form nickel chloride.

These reactions represent the transformation of the given compounds in sequential steps.