Question

Ba(OH)2+?-Ba(No3)2+?

Answer 1

Ba(OH)2+2HNO3=Ba(NO3)2+2H2O

Answer 2

The balanced chemical equation for the reaction between barium hydroxide (Ba(OH)2) and barium nitrate (Ba(NO3)2) is:

Ba(OH)2 + 2 HNO3 → Ba(NO3)2 + 2 H2O

In this equation, one molecule of Ba(OH)2 reacts with two molecules of HNO3 (nitric acid) to produce one molecule of Ba(NO3)2 (barium nitrate) and two molecules of water (H2O).

Therefore, the balanced ionic equation for this reaction (in aqueous solution) is:

Ba2+(aq) + 2 OH-(aq) + 2 H+(aq) + 2 NO3-(aq) → Ba2+(aq) + 2 NO3-(aq) + 2 H2O(l)

The spectator ions in this equation are the nitrate ions (NO3-), which appear on both sides of the equation and therefore do not participate in the reaction. Thus, the net ionic equation for this reaction is:

Ba2+(aq) + 2 OH-(aq) → Ba(OH)2(s)

This equation shows that the barium ions (Ba2+) and hydroxide ions (OH-) react to form solid barium hydroxide (Ba(OH)2).