Question

S-SO2-Na2SO3-Na3PO4-Zn3(PO4)2        |                                              |   H2SO3                                  ZnOH                                                       |                                                     ZnO 

Answer 1

S + O2 = SO2

SO2 + H2O = H2SO3

SO2 + Na2O = Na2SO3

3Na2SO3 +2 H3PO4 = 2Na3PO4 + 3H2SO3

2Na3PO4 + 3Zn(NO3)2 = Zn3(PO4)2 (осадок )+ 6NaNO3

Zn3(PO4)2 + 6KOH = 3Zn(OH)2 (осадок) + 2K3PO4

Zn(OH)2 = ZnO + H2O    при нагревании

Answer 2

The given sequence of chemical compounds and elements can be rearranged into a chemical reaction as follows:

S + SO2 + Na2SO3 + Na3PO4 + Zn3(PO4)2 → H2SO3 + ZnOH + ZnO

The reaction involves the combination of sulfur (S), sulfur dioxide (SO2), sodium sulfite (Na2SO3), sodium phosphate (Na3PO4), and zinc phosphate (Zn3(PO4)2) to produce sulfurous acid (H2SO3), zinc hydroxide (ZnOH), and zinc oxide (ZnO).

Please note that the balancing coefficients for each compound are not provided, so it is not possible to determine the stoichiometric ratios and fully balance the equation.