Question

CO-CO(NO3)2-Co(OH)2-CoCl2

Answer 1

1)3Co+8HNO3(разб)=3Co(NO3)2+2NO+4H2O2)Co(NO3)2+2KOH=Co(OH)2↓+2KNO3
Co(OH)2+2HCl=CoCl2+H2O

Answer 2

CO-CO(NO3)2 is not a valid chemical formula. A chemical formula typically consists of chemical symbols representing the elements present in the compound and subscripts indicating the number of atoms of each element. However, I can provide information on the compounds you mentioned individually: Co(OH)2 and CoCl2.

Co(OH)2 is the chemical formula for Cobalt(II) hydroxide. It is a compound that consists of one cobalt atom bonded to two hydroxide ions. Cobalt(II) hydroxide is a blue solid that is sparingly soluble in water. When it dissolves in water, it forms a slightly basic solution due to the presence of hydroxide ions.

CoCl2 is the chemical formula for Cobalt(II) chloride. It is a compound that consists of one cobalt atom bonded to two chloride ions. Cobalt(II) chloride is a pink solid that is highly soluble in water. It can undergo hydration reactions, where it forms different hydrates depending on the number of water molecules attached to the cobalt ion.

If you have a specific question about these compounds or need further information, please let me know.