Question

Укажите название соединения CH2=C(CH3)-CH(C2H5)-CH2-CH2-CH(C2H5)-CH3 ?

Answer 1

2метил 3,6 диэтил гексен 

Считаем от двойной связи

Answer 2

Chemical Compound Name for CH2=C(CH3)-CH(C2H5)-CH2-CH2-CH(C2H5)-CH3

The chemical compound name for the given structure CH2=C(CH3)-CH(C2H5)-CH2-CH2-CH(C2H5)-CH3 is 2-methyl-3-ethylhex-2-ene.

This compound is a type of alkene with a specific arrangement of carbon and hydrogen atoms, as indicated by the chemical structure provided.

[[1]](https://www.igma.ru/sveden/files/Metod_test_organ_him_2017.pdf)(#1)(#2)(#3)(#8)(#10)