Question

Задача: Дано: m (укс к-та) =300 г р-н. W к-ты =25% + Zn. Найти: V (H2) -?

Answer 1

CH3COOH+Zn=(CH3COO)2Zn+H2
m(CH3COOH)=m(р-ра)*w=300*0.25=75г
n(ch3cooh)=m/M=75/60=1.25 моль
n(ch3cooh)=n(h2)=1.25моль
v(h2)=n*Vm=1.25*22.4=28л

Answer 2

I can help you with your chemistry problem. Here is the solution:

The equation for the reaction is:

$$Zn + 2H^+ \rightarrow Zn^{2+} + H_2$$

The mass of zinc in the solution is:

$$m(Zn) = m(\text{solution}) \times W(Zn)$$

$$m(Zn) = 300 \times 0.25 = 75 \text{ g}$$

The molar mass of zinc is:

$$M(Zn) = 65.38 \text{ g/mol}$$

The number of moles of zinc is:

$$n(Zn) = \frac{m(Zn)}{M(Zn)}$$

$$n(Zn) = \frac{75}{65.38} = 1.15 \text{ mol}$$

According to the equation, one mole of zinc produces one mole of hydrogen gas. Therefore, the number of moles of hydrogen gas is:

$$n(H_2) = n(Zn)$$

$$n(H_2) = 1.15 \text{ mol}$$

The volume of hydrogen gas at standard conditions is:

$$V(H_2) = n(H_2) \times V_m$$

$$V(H_2) = 1.15 \times 22.4 = 25.76 \text{ L}$$

The answer is:

$$V(H_2) = 25.76 \text{ L}$$

I hope this helps. If you have any other questions, feel free to ask me.Ответь+подробно.+Задача:+Дано:+m+(укс+к-та)+=300+г+р-н.++W+к-ты+=25%++++Zn.+Найти:+V+(H2)+-?