Вопрос задан 24.02.2019 в 16:04. Предмет Химия. Спрашивает Нехай Анастасия.

Напишите уравнения реакций ацилирования и метилирования крахмала, назовите продукты.Пожалуйста

ничего не получается найти((Нашла только что ацилирование это будет взаимодействие с уксусной кислотой,а метилирование с диметилсульфатом. Помогите с уравнениями плиз
0 0
Перейти к ответам

Ответы на вопрос

Внимание! Ответы на вопросы дают живые люди. Они могут содержать ошибочную информацию, заблуждения, а также ответы могут быть сгенерированы нейросетями. Будьте внимательны. Если вы уверены, что ответ неверный, нажмите кнопку "Пожаловаться" под ответом.
Отвечает Соболева Виктория.
N(C6H10O5)+3nCH3CO-O-COCH3-> n(C6H7O5(COCH3)3)+3CH3COOH - ацилирование
Ацилирование - образование сложных эфиров, путём замещения водорода в гидроксильной группе(OH) на ацил(CH3CO) группу.
n(C6H10O5)+nCH3OH-(HClгаз)>n(C6H9O5(CH3))+nH2O - метилирование
Метилирование - образование простых эфиров, путём замещения водорода в гидроксильной группе на метиловую(CH3) группу.
0 0
Отвечает нейросеть ChatGpt. Будьте внимательны, ответы нейросети могут содержать ошибочные или выдуманные данные.

Acylation of Starch:

The acylation of starch involves the reaction of starch with an acylating agent, such as acetic anhydride or acetyl chloride, in the presence of a catalyst. This reaction introduces acyl groups (RCO-) onto the starch molecule. The acylation reaction can be represented by the following equation:

Starch + Acylating Agent → Acylated Starch + Byproducts

The specific acylating agent used will determine the acyl group that is introduced onto the starch molecule. For example, if acetic anhydride is used as the acylating agent, the acyl group introduced will be the acetyl group (CH3CO-).

Methylation of Starch:

The methylation of starch involves the reaction of starch with a methylating agent, such as dimethyl sulfate or methyl iodide. This reaction introduces methyl groups (CH3-) onto the starch molecule. The methylation reaction can be represented by the following equation:

Starch + Methylating Agent → Methylated Starch + Byproducts

The specific methylating agent used will determine the number and position of methyl groups introduced onto the starch molecule.

Please note that the acylation and methylation reactions of starch are complex processes, and the specific reaction conditions and catalysts used can vary. The equations provided above are general representations of the reactions and may not capture all the details of the actual reactions. It is always recommended to consult reliable scientific literature or sources for more specific information on the acylation and methylation of starch.

0 0

Топ вопросов за вчера в категории Химия

Последние заданные вопросы в категории Химия

Задать вопрос