Question

определите объемы этилена и хлора при нормальных условиях необходимые для получения дихлорэтана массой 19,8г

Answer 1

C2H4+Cl2=C2H4Cl2

 

1) n(C2H4Cl2)=m(C2H4Cl2 )/M(C2H4Cl2)=19.8/99=0.2

 

2) n(C2H4Cl2)=n(C2H4)=n(Cl2)=0.2

 

3) V(Cl2)=n(Cl2)*V=0.2*22.4=4.48

 

4) V(C2H4)=n(C2H4)*V=0.2*22.4=4.48

Answer 2

Calculating the Volume of Ethylene and Chlorine for the Production of 1,2-Dichloroethane

To calculate the volumes of ethylene and chlorine required to produce 1,2-dichloroethane with a mass of 19.8g, we can use the balanced chemical equation for the reaction between ethylene and chlorine to produce 1,2-dichloroethane.

The balanced chemical equation for the reaction is: C2H4 + Cl2 → C2H4Cl2

From the balanced chemical equation, we can see that 1 mole of ethylene reacts with 1 mole of chlorine to produce 1 mole of 1,2-dichloroethane.

Step 1: Calculate the Moles of 1,2-Dichloroethane

To calculate the moles of 1,2-dichloroethane, we use the formula: moles = mass / molar mass

The molar mass of 1,2-dichloroethane (C2H4Cl2) is the sum of the molar masses of its constituent atoms: - Carbon (C): 12.01 g/mol - Hydrogen (H): 1.008 g/mol - Chlorine (Cl): 35.45 g/mol

Molar mass of 1,2-dichloroethane = (2 * molar mass of C) + (4 * molar mass of H) + (2 * molar mass of Cl)

Step 2: Calculate the Moles of Ethylene and Chlorine

Since the reaction is 1:1 between ethylene and chlorine, the moles of ethylene and chlorine required will be the same as the moles of 1,2-dichloroethane.

Step 3: Convert Moles to Volume

To convert moles to volume, we can use the ideal gas law: PV = nRT Where: P = pressure V = volume n = moles R = ideal gas constant T = temperature

We can assume standard temperature and pressure (STP) for the calculation, where the temperature is 273.15 K and the pressure is 1 atm.

Let's calculate the moles of 1,2-dichloroethane and then use the ideal gas law to find the volumes of ethylene and chlorine required.

Conclusion:

By following the steps outlined above, we can calculate the volumes of ethylene and chlorine required to produce 1,2-dichloroethane with a mass of 19.8g.