Question

Во многих домашних аптечках имеется водный раствор вещества, которое было известно ещё с глубокой древности. В оазисе Аммона в 1500г. до н.э. арабы во время обрядов нагревали "нушадир" с белой известью и получали газ с характерным запахом. Что это за газ? Какой объем и какое количество газа образуется из 10,7г "нушадира"? Достаточно ли этого количества газа для наполнения аптечного пузырька, если массовая доля растворенного газа в растворе должна быть 4,5%?

Answer 1

Аммон... аммоний... аммиак! Скорее всего, наш газ - аммиак. Его водный раствор, называемый нашатырным спиртом - гидроксид аммония - можно и впрямь найти в любой аптечке.

"Нушадир" созвучно с "нашатырь". Нашатырь (не путать с тем же нашатырным спиртом!) - это пр родный минерал, состоящий из хлорида аммония. А белая известь - это твердый гидроксид кальция.

2NH4Cl+Ca(OH)2-->CaCl2+2NH3↑+2H2O

n(NH4Cl)=m(NH4Cl)/M(NH4Cl)=10,7г/53,5г/моль=0,2 моль

n(NH3)=n(NH4Cl)=0,2 моль - именно такое химическое количество газа можно получиь из 10,7 г нашатыря.

V(NH3)=n*Vm=0,2моль*22,4л/моль=4,48 л - и именно такой его объем.

m(NH3)=n*M=0,2моль*17г/моль=3,4 г

m(раствора)=m(NH3)/w(NH3)=3,4г/0,045≈75,6 г. Учитывая, что плотность раствора примерно равна 1 г/см^3, объем раствора выходит 75,6 мл.

Ну а дальше уже зависит от объема пузырька! Есть пузырьки объемом и 10, и 20, и 30, вплоть до 100 мл... Газа может хватить, а может и не хватить)

Answer 2

I'm sorry, but I couldn't find any specific search results for the information you provided about the substance "нушадир" and the gas it produces. It seems to be a term or substance that is not widely known or documented. However, I can provide some general information about gases and their properties that might help you understand the concept better.

Gases are substances that can expand to fill the entire volume of their container. They are composed of individual particles, such as atoms or molecules, that are in constant motion and have a lot of space between them. Gases can be produced through various processes, such as chemical reactions or physical changes.

The volume of gas produced depends on several factors, including the amount of the substance involved and the conditions under which the gas is produced. To determine the volume of gas produced from a given amount of substance, you would need to know the stoichiometry of the reaction or the specific conditions of the process.

In the case of the "нушадир" substance you mentioned, without further information or specific chemical properties, it is difficult to determine the exact volume of gas produced from 10.7 grams of the substance. Additionally, the specific gas produced and its properties are not mentioned, making it challenging to provide a precise answer.

Regarding the question of whether the amount of gas produced is sufficient to fill a pharmacy vial with a desired mass fraction of dissolved gas, it would depend on the specific requirements and the volume of the vial. To calculate the amount of gas needed to achieve a certain mass fraction, you would need to know the molar mass of the gas and the desired mass fraction.

In summary, without more information about the substance "нушадир" and its properties, it is challenging to provide a detailed answer to your question. If you have any additional information or specific details, please let me know, and I'll do my best to assist you further.