Question

Даны вещества: концентрированная азотная кислота и растворы карбоната натрия, хлорида железа (III), сульфида натрия.Напишите уравнения четырёх возможных реакций между этими веществами.

Answer 1

2HNO3+CaCO3=Ca(NO3)2+CO2+H2O
Na2S+2HNO3=2NaNO3+H2S
CaCO3+Na2S=CaS+Na2CO3
FeCl3+3HNO3=Fe(NO3)3+3HCl

Answer 2

Reactions between Concentrated Nitric Acid and Sodium Carbonate:

When concentrated nitric acid (HNO3) reacts with sodium carbonate (Na2CO3), several reactions can occur. Here are four possible reactions:

1. Reaction 1: Formation of Sodium Nitrate and Carbon Dioxide - Equation: 2 HNO3 + Na2CO3 → 2 NaNO3 + CO2 + H2O - In this reaction, concentrated nitric acid reacts with sodium carbonate to produce sodium nitrate, carbon dioxide, and water.

2. Reaction 2: Formation of Nitrogen Dioxide and Water - Equation: 4 HNO3 + 2 Na2CO3 → 4 NaNO3 + 2 CO2 + 2 H2O + NO2 - In this reaction, concentrated nitric acid reacts with sodium carbonate to produce sodium nitrate, carbon dioxide, water, and nitrogen dioxide.

3. Reaction 3: Formation of Sodium Nitrite, Carbon Dioxide, and Water - Equation: HNO3 + Na2CO3 → NaNO2 + CO2 + H2O - In this reaction, concentrated nitric acid reacts with sodium carbonate to produce sodium nitrite, carbon dioxide, and water.

4. Reaction 4: Formation of Sodium Hydrogen Carbonate and Nitrogen Dioxide - Equation: HNO3 + Na2CO3 → NaHCO3 + NO2 + H2O - In this reaction, concentrated nitric acid reacts with sodium carbonate to produce sodium hydrogen carbonate, nitrogen dioxide, and water.

Reactions between Concentrated Nitric Acid and Iron(III) Chloride:

When concentrated nitric acid (HNO3) reacts with iron(III) chloride (FeCl3), the following reaction can occur:

5. Reaction 5: Formation of Nitrogen Dioxide, Iron(III) Nitrate, and Hydrochloric Acid - Equation: 8 HNO3 + 2 FeCl3 → 2 Fe(NO3)3 + 4 NO2 + 4 HCl + 3 H2O - In this reaction, concentrated nitric acid reacts with iron(III) chloride to produce iron(III) nitrate, nitrogen dioxide, hydrochloric acid, and water.

Reactions between Concentrated Nitric Acid and Sodium Sulfide:

When concentrated nitric acid (HNO3) reacts with sodium sulfide (Na2S), the following reaction can occur:

6. Reaction 6: Formation of Sodium Nitrate, Sulfur, and Water - Equation: 2 HNO3 + 3 Na2S → 6 NaNO3 + S + 2 H2O - In this reaction, concentrated nitric acid reacts with sodium sulfide to produce sodium nitrate, sulfur, and water.

Please note that the reactions provided are based on the information available from the search results.