Question

4-метил-1,1,5,5-тетрахлорпентин-2

Answer 1

На фотографии как раз

Answer 2

I believe there might be a typo in the chemical name you provided. It seems to be incomplete or incorrect. Chemical names typically follow specific rules to represent the structure of a molecule accurately. Let's try to correct it or make an assumption about the intended chemical name.

Based on what you provided, I will assume the correct name is "4-methyl-1,1,5,5-tetrachloropentane-2."

This name represents a hydrocarbon molecule with the following structure:

CH3-CH(CH3)-CH2-CH(Cl)-CH(Cl)-CH2-CH2-CH3

The molecule has a pentane backbone (5 carbon atoms in a chain) with methyl (CH3) groups attached to the 4th carbon and 2nd carbon. Additionally, there are chlorine (Cl) atoms attached to the 1st and 5th carbon atoms.

Please note that chemical names can vary in structure and complexity depending on the molecule being described. If you have a different chemical name you'd like me to explain or if there was a mistake in the provided name, feel free to clarify, and I'll be happy to help!