Question

Fe(OH)3=Fe2(SO4)3=Fe(OH)3​

Answer 1

Ответ:

Fe(OH)3 + 3H2SO4 = Fe2(SO4)3 + 6H2O

Fe2(SO4)3 + 6NaOH = 2Fe(OH)3 + 3Na2SO4

Answer 2

It seems there might be some confusion in your chemical equation or statement. Fe(OH)3, Fe2(SO4)3, and Fe(OH)3 are different chemical compounds, and they cannot be equated in a simple way.

1. Fe(OH)3: This represents iron(III) hydroxide, which is a chemical compound consisting of iron (Fe) and hydroxide ions (OH-).

2. Fe2(SO4)3: This represents iron(III) sulfate, a chemical compound that consists of iron (Fe) and sulfate ions (SO4^2-). The correct formula for iron(III) sulfate is Fe2(SO4)3, not Fe(OH)3.

3. Fe(OH)3: This is the same as the first compound, iron(III) hydroxide.

If you are trying to equate these compounds or express a chemical reaction involving them, you would need to provide more context or information about the reaction or the purpose of the equating. Chemical reactions typically involve reactants and products, and these compounds would participate in reactions in different ways due to their distinct chemical compositions.