Question

CH3-CH2-CH(OH)-CH2(OH)->x1->x2___KMnO4,H2SO4->CH3-CH2-COOH->x3->CH3-CH(NH2)-COOH

Answer 1

Ответ:

Объяснение:

Спирты проявляют основные свойства, взаимодействую с галогенводородными кислотами (*с щелочами не взаимодействуют)

CH3-CH2-CH(OH)-CH2(OH)+2HCl → CH3-CH2-CH(Cl)-CH2(Cl)+2H2O

Теперь от нас требую создать кратную связь. Можно создать тройную, действуя избытком спиртового раствора щёлочи, а можно двойную

CH3-CH2-CH(Cl)-CH2(Cl)+Zn → CH3-CH2-CH=CH2+ZnCl2

Окисление перманганатом калия в кислой среде природит к разрыву связи и образованию соотвутствующих кислот (угольная кислота неустойчива и разлагается на углекислый газ и воду)

CH3-CH2-CH=CH2+2KMnO4+3H2SO4 → CH3-CH2-COOH+CO2↑+K2SO4+2MnSO4+4H2O

Бромирование (почему бы не хлорировать?) на свету или при нагревании

CH3-CH2-COOH+Br2 → CH3-CH(Br)-COOH+HBr

Классическое получение аминов

CH3-CH(Br)-COOH+NH3 → CH3-CH(NH2)-COOH+HBr

Answer 2

The chemical reaction you provided seems to involve several steps. Let's break it down step by step:

Step 1: Oxidation of Secondary Alcohol to Ketone CH3-CH2-CH(OH)-CH2(OH) + [O] → CH3-CH2-CO-CH2(OH) (x1)

In this step, the secondary alcohol CH3-CH2-CH(OH)-CH2(OH) is oxidized using an oxidizing agent ([O]) to form a ketone, CH3-CH2-CO-CH2(OH) (x1).

Step 2: Acid-Catalyzed Dehydration CH3-CH2-CO-CH2(OH) → CH3-CH2-CO-CH2 + H2O (x2)

In this step, the ketone undergoes acid-catalyzed dehydration, resulting in the removal of water and the formation of CH3-CH2-CO-CH2 (x2).

Step 3: Oxidation of Ketone to Carboxylic Acid CH3-CH2-CO-CH2 + KMnO4, H2SO4 → CH3-CH2-COOH (x3)

In this step, the ketone CH3-CH2-CO-CH2 (x2) reacts with potassium permanganate (KMnO4) in the presence of sulfuric acid (H2SO4) to undergo oxidation, converting the ketone group to a carboxylic acid group. This results in the formation of CH3-CH2-COOH (x3).

Step 4: Decarboxylation and Amino Group Addition CH3-CH2-COOH → CH3-CH(NH2)-COOH

In this step, the carboxylic acid CH3-CH2-COOH (x3) undergoes decarboxylation, resulting in the removal of carbon dioxide (CO2) and the formation of CH3-CH(NH2)-COOH.

Overall, the reaction sequence can be summarized as follows: CH3-CH2-CH(OH)-CH2(OH) → x1 → x2 → KMnO4, H2SO4 → CH3-CH2-COOH → x3 → CH3-CH(NH2)-COOH