Question

K(OH)+Zn(OH2),H2SO4+NaOH,Zn(OH)2,Ba(NO3)2,NaOH

Answer 1

ZN(OH)2 + 2 KOH = K2ZNO2 + 2 H2O

H2SO4 + 2NaOH → Na2SO4 + 2H2O

Ba(NO3)2 + 2KOH = Ba(OH)2 + 2KNO3

2 KOH + H2So4 = K2So4 + 2 H2O

H2So4 + ZN(OH)2 = ZNSo4 + 2 H2O

H2SO4 + 2NaOH → Na2SO4 + 2H2O

Ba(NO3)2+H2SO4=BaSO4+2HNO3

Zn(OH)2 + H2SO4 → ZnSO4 + 2 H2O

Answer 2

It appears that you're providing a sequence of chemical reactions. Let's break down each step:

1. K(OH) + Zn(OH)2: This reaction does not occur because potassium hydroxide (KOH) and zinc hydroxide (Zn(OH)2) do not undergo a reaction.

2. H2SO4 + NaOH: This is a neutralization reaction between sulfuric acid (H2SO4) and sodium hydroxide (NaOH), resulting in the formation of water (H2O) and sodium sulfate (Na2SO4): H2SO4 + 2NaOH -> 2H2O + Na2SO4

3. Zn(OH)2 + Ba(NO3)2: This reaction does not occur between zinc hydroxide (Zn(OH)2) and barium nitrate (Ba(NO3)2) since no insoluble precipitate or reaction is expected.

4. NaOH + Zn(OH)2: This is a double displacement reaction between sodium hydroxide (NaOH) and zinc hydroxide (Zn(OH)2), resulting in the formation of sodium zincate (Na2ZnO2) and water (H2O): 2NaOH + Zn(OH)2 -> Na2ZnO2 + 2H2O

5. Ba(NO3)2 + NaOH: This is a double displacement reaction between barium nitrate (Ba(NO3)2) and sodium hydroxide (NaOH), resulting in the formation of barium hydroxide (Ba(OH)2) and sodium nitrate (NaNO3): Ba(NO3)2 + 2NaOH -> Ba(OH)2 + 2NaNO3

I hope this clarifies the reactions for you. Let me know if you have any further questions!