Question

Br2+Sr(OH)=SrBr2+Sr(BrO3)2+H2O

Answer 1

Сбалансированное уравнение:
12 Br2 + 12 Sr(OH) = 11 SrBr2 + Sr(BrO3)2 + 6 H2O

Answer 2

The chemical equation you provided seems to be incorrect or incomplete. It appears to show a reaction between bromine (Br2) and strontium hydroxide (Sr(OH)2), but the products are not balanced correctly.

If we assume the reaction proceeds as follows:

Br2 + Sr(OH)2 → SrBr2 + Sr(BrO3)2 + H2O

Then we need to balance the equation. Let's start by counting the number of atoms on both sides:

Bromine (Br):

• Left side: 2 atoms (from Br2)
• Right side: 2 atoms (from SrBr2) + 2 atoms (from Sr(BrO3)2) = 4 atoms

Strontium (Sr):

• Left side: 1 atom (from Sr(OH)2)
• Right side: 1 atom (from SrBr2) + 1 atom (from Sr(BrO3)2) = 2 atoms

Hydrogen (H):

• Left side: 2 atoms (from H2O)
• Right side: 0 atoms

Oxygen (O):

• Left side: 2 atoms (from Sr(OH)2) + 1 atom (from H2O) = 3 atoms
• Right side: 6 atoms (from Sr(BrO3)2)

The equation is currently unbalanced since the number of atoms on both sides doesn't match. To balance it, we can adjust the coefficients:

Br2 + 3 Sr(OH)2 → 3 SrBr2 + 2 Sr(BrO3)2 + 3 H2O

Now let's check the atom counts again:

Bromine (Br): 2 atoms on both sides Strontium (Sr): 3 atoms on both sides Hydrogen (H): 6 atoms on both sides Oxygen (O): 8 atoms on both sides

Now the equation is balanced, and it shows the reaction between bromine and strontium hydroxide to produce strontium bromide, strontium bromate, and water.