Question

CA⇒CAO⇒CA(OH)2⇒CA(NO3)2⇒CA3(PO)42⇒AL(NO3)2

Answer 1

2Ca+O2=2CaO
CaO+H2O=Ca(OH)2
Ca(OH)2+2HNO3=Ca(NO3)2+2H2O
3Ca(NO3)2+2H3PO4=Ca3(PO4)2+6HNO3
а последнее не могу сделать

Answer 2

It seems like you're providing a sequence of chemical reactions. Here's a breakdown of the reactions you've mentioned:

1. CA → CAO: This reaction involves the conversion of calcium (CA) to calcium oxide (CAO). It is commonly known as a thermal decomposition reaction.

2. CAO → CA(OH)2: This reaction involves the reaction of calcium oxide (CAO) with water, resulting in the formation of calcium hydroxide (CA(OH)2). This reaction is known as slaked lime formation.

3. CA(OH)2 → CA(NO3)2: This reaction involves the reaction of calcium hydroxide (CA(OH)2) with nitric acid (HNO3), leading to the formation of calcium nitrate (CA(NO3)2).

4. CA(NO3)2 → CA3(PO)42: This reaction appears to be incorrect as it doesn't follow the usual chemical formulas. It seems you intended to write CA(NO3)2 → CA3(PO4)2, which would represent the reaction between calcium nitrate (CA(NO3)2) and phosphoric acid (H3PO4), resulting in the formation of calcium phosphate (CA3(PO4)2).

5. CA3(PO4)2 → AL(NO3)2: This reaction indicates the conversion of calcium phosphate (CA3(PO4)2) to aluminum nitrate (AL(NO3)2). However, this reaction doesn't typically occur between these compounds. Calcium phosphate and aluminum nitrate are separate chemical compounds and would not directly react to produce each other.

If you have any specific questions or require further clarification, feel free to ask!