Question

N2-No-No2-HNo3-(No)-NaNo-NaNo2

Answer 1

N2+O2->2NO, 2NO+O2->2NO2, 3NO2+H2O->2HNO3+NO, 3Cu+8HNO3(разб.)->3Cu(NO3)2+2NO+4H2O, а дальше незнаю

Answer 2

The sequence you provided appears to be a combination of chemical formulas and symbols. Here's a breakdown of each component:

1. N2: This represents a molecule of nitrogen gas, which consists of two nitrogen atoms bonded together.

2. No: This appears to be a typographical error or a misrepresentation. If you meant "NO," it represents a molecule of nitric oxide, which consists of one nitrogen atom bonded to one oxygen atom.

3. No2: This represents a molecule of nitrogen dioxide, which consists of one nitrogen atom bonded to two oxygen atoms.

4. HNo3: This represents a molecule of nitric acid, which consists of one nitrogen atom, three oxygen atoms, and one hydrogen atom.

5. (No): The parentheses around "No" suggest that it might be a subscript or a charge associated with the previous component. However, "No" is not commonly used as a chemical notation, so it's unclear what it represents.

6. NaNo: This is not a recognized chemical formula. If you meant "NaNO," it could represent sodium nitrite, which consists of one sodium atom and one nitrite ion (NO2-) combined.

7. NaNo2: This represents sodium nitrate, which consists of one sodium atom and one nitrate ion (NO3-) combined.

Please note that the provided sequence contains inconsistencies and potential errors. If you have a specific question or require further clarification, please let me know, and I'll be happy to assist you.