Question

P-P2O5-H3PO4-Ca3(PO4)2-H3PO4

Answer 1

4P + 5O2 = 2P2O5
P2O5 + 3H2O = 2H3PO4
3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
Ca3(PO4)2 + 3H2SO4 = 3CaSO4 + 2H3PO4

Answer 2

The sequence of chemicals you provided is as follows:

P - Phosphorus P2O5 - Phosphorus Pentoxide H3PO4 - Phosphoric Acid Ca3(PO4)2 - Calcium Phosphate

Phosphorus (P) is a chemical element with the symbol P and atomic number 15. It is a non-metal and exists in various forms, such as white phosphorus, red phosphorus, and black phosphorus.

Phosphorus Pentoxide (P2O5) is a compound formed by combining two atoms of phosphorus and five atoms of oxygen. It is a white, powdery substance and is a potent dehydrating agent commonly used in chemical reactions and laboratory procedures.

Phosphoric Acid (H3PO4) is an inorganic acid formed by dissolving P2O5 in water. It is a colorless, viscous liquid and is widely used in various industries, including food and beverage, fertilizers, and detergents. Phosphoric acid is also a key component in the production of phosphate-based fertilizers.

Calcium Phosphate (Ca3(PO4)2) is a compound composed of three calcium ions (Ca2+) and two phosphate ions (PO43-). It is a white, crystalline solid and is the primary component of minerals such as hydroxyapatite, which is found in teeth and bones. Calcium phosphate is commonly used as a supplement to support bone health and is also used as a dietary additive.

Overall, the sequence you provided includes phosphorus in different forms, phosphoric acid, and calcium phosphate. These chemicals have various applications in different fields, including industrial, agricultural, and pharmaceutical sectors.