Question

3 3 4 триметилгексен 1 срочно!!!

Answer 1

CH2=CH-C(CH3)2-CH(CH3)-CH2-CH3

Answer 2

3 + 3 + 4 + триметилгексен = 13

The sum of 3, 3, 4, and триметилгексен is 13.

Please note that триметилгексен is a chemical compound and not a numerical value. If you are referring to a specific numerical value for триметилгексен, please provide more context or clarify your question.