Question

N2-NH3-N2-NO2-HNO3-Ca-Ca(NO3)2

Answer 1

N2 → NO → NO2 → HNO3 → Ca(NO3)2
N2 + O2 = 2NO условия :2000 °C,
NO + O3 = NO2 + O2 условия :при комнатной температуре
3NO2 + H2O = 2HNO3 + NO условия :При нагревании
CaO + 2HNO3 = Ca(NO3)2 + H2O

Answer 2

Chemical Reaction: N2 - NH3 - N2 - NO2 - HNO3 - Ca - Ca(NO3)2

The given chemical reaction involves the conversion of nitrogen gas (N2) to ammonia (NH3), then back to nitrogen gas (N2), followed by the formation of nitrogen dioxide (NO2) and nitric acid (HNO3). Finally, calcium (Ca) reacts with nitric acid (HNO3) to form calcium nitrate (Ca(NO3)2).

Let's break down the reaction step by step:

1. Conversion of N2 to NH3: - Nitrogen gas (N2) reacts with hydrogen gas (H2) under appropriate conditions to form ammonia (NH3). - The balanced equation for this reaction is: N2 + 3H2 → 2NH3.

2. Conversion of NH3 to N2: - Ammonia (NH3) can be decomposed back into nitrogen gas (N2) and hydrogen gas (H2) through a process called the Haber-Bosch process. - The balanced equation for this reaction is: 2NH3 → N2 + 3H2.

3. Formation of NO2: - Nitrogen gas (N2) reacts with oxygen gas (O2) under appropriate conditions to form nitrogen dioxide (NO2). - The balanced equation for this reaction is: N2 + 2O2 → 2NO2.

4. Formation of HNO3: - Nitrogen dioxide (NO2) reacts with water (H2O) to form nitric acid (HNO3). - The balanced equation for this reaction is: 3NO2 + H2O → 2HNO3 + NO.

5. Reaction of Ca with HNO3: - Calcium (Ca) reacts with nitric acid (HNO3) to form calcium nitrate (Ca(NO3)2) and hydrogen gas (H2). - The balanced equation for this reaction is: 3Ca + 8HNO3 → 3Ca(NO3)2 + 2NO + 4H2O.

Please note that the given reaction is a combination of multiple reactions, and the overall reaction is not balanced. The balanced equations provided above represent the individual reactions involved.

I hope this explanation helps! Let me know if you have any further questions.