Question

fe2o3 + h2so4= решите пожалуйста

Answer 1

Fe2O3+3H2SO4=Fe2(SO4)3+3H2O

Answer 2

Fe2O3 + H2SO4 = Fe2(SO4)3 + H2O

Answer 3

Balancing Chemical Equation Fe2O3 + H2SO4

To balance the chemical equation Fe2O3 + H2SO4, we need to ensure that the number of atoms of each element is the same on both sides of the equation.

The unbalanced equation is: Fe2O3 + H2SO4 → Fe2(SO4)3 + H2O

To balance it, we can follow these steps:

1. Balance the metals. 2. Balance the non-metals. 3. Balance the hydrogen and oxygen atoms.

Balancing Steps

1. Balance the metals: - There are 2 iron (Fe) atoms on the left side and 2 on the right side. This is already balanced. 2. Balance the non-metals: - There are 3 sulfur (S) atoms on the right side, so we need to put a coefficient of 3 in front of H2SO4 to balance the sulfur atoms.

3. Balance the hydrogen and oxygen atoms: - After balancing the sulfur, we have 8 hydrogen (H) atoms on the right side. To balance the hydrogen, we need to put a coefficient of 3 in front of H2O.

Balanced Equation

The balanced chemical equation for Fe2O3 + H2SO4 is: 2Fe2O3 + 3H2SO4 → Fe2(SO4)3 + 3H2O

This balanced equation ensures that the number of atoms of each element is the same on both sides of the equation.