Question

Cr-Cr2O3-Cr-CrCl3-Cr(OH)3-Cr(NO3)3

Answer 1

4Cr  + 3O2 -> 2Cr2O3

Cr2O3 +2 Al -> Al2O3 + 2Cr

2Cr + 3Cl2 -> 2CrCl3

CrCl3 + 3NaOH -> Cr(OH)3 + 3NaCl

Cr(OH)3 + 3HNO3 -> Cr(NO3)3 + 3H2O

Answer 2

Chemical Compounds in the Given Sequence

The given sequence of chemical compounds is as follows: Cr-Cr2O3-Cr-CrCl3-Cr(OH)3-Cr(NO3)3.

1. Cr: Cr is the chemical symbol for the element chromium. [[1]](https://elar.urfu.ru/bitstream/10995/40625/1/978-5-7996-1780-6_2016.pdf) 2. Cr2O3: Cr2O3 is the chemical formula for chromium(III) oxide, also known as chromic oxide.3. CrCl3: CrCl3 is the chemical formula for chromium(III) chloride.4. Cr(OH)3: Cr(OH)3 is the chemical formula for chromium(III) hydroxide.5. Cr(NO3)3: Cr(NO3)3 is the chemical formula for chromium(III) nitrate.

Chemical Reactions and Transformations

The given sequence of chemical compounds can be related to various chemical reactions and transformations. Here are a few examples:

1. Cr2O3 + Na2O → 2NaCrO2: Chromium(III) oxide reacts with sodium oxide to form sodium chromate.2. NaCrO2 + HCl → Cr(OH)3 + NaCl: Sodium chromate reacts with hydrochloric acid to produce chromium(III) hydroxide and sodium chloride.3. NaCrO2 + 4HCl → CrCl3 + NaCl + 2H2O: Sodium chromate reacts with hydrochloric acid to yield chromium(III) chloride, sodium chloride, and water. [[7]](https://chemege.ru/chrom/) 4. Cr2(SO4)3 + 3K2CO3 + 3H2O → 2Cr(OH)3 + 3CO2 + 3K2SO4: Chromium(III) sulfate reacts with potassium carbonate and water to form chromium(III) hydroxide, carbon dioxide, and potassium sulfate.

Conclusion

In summary, the given sequence of chemical compounds includes chromium and its various compounds such as chromium(III) oxide, chromium(III) chloride, chromium(III) hydroxide, and chromium(III) nitrate. These compounds can undergo chemical reactions and transformations to form different products.