Question

Окислительно-восстановительные реакции1)CoCl2+F2->CoF3+Cl22)K3PO3+AgNO3->KN03+Ag3PO43)Cu(OH)2+HNO3->Cu(NO3)2+H2O4)FeBr2+Cl2->FeCl3+Br25)FeSO3+K2Cr2O7+H2SO4->Fe2(SO4)3+K2SO4+Cr(SO4)3+H2O

Answer 1

проверь формулы

сначала

 

 

Answer 2

Oxidation-Reduction Reactions

1) CoCl2 + F2 -> CoF3 + Cl2 - This is a redox reaction where cobalt(II) chloride (CoCl2) reacts with fluorine gas (F2) to form cobalt(III) fluoride (CoF3) and chlorine gas (Cl2). - In this reaction, cobalt undergoes oxidation from +2 to +3 oxidation state, while fluorine undergoes reduction from 0 to -1 oxidation state. - The balanced equation for this reaction is: CoCl2 + F2 -> CoF3 + Cl2.

2) K3PO3 + AgNO3 -> KN03 + Ag3PO4 - This is also a redox reaction where potassium phosphite (K3PO3) reacts with silver nitrate (AgNO3) to form potassium nitrate (KN03) and silver phosphate (Ag3PO4). - In this reaction, silver undergoes reduction from +1 to 0 oxidation state, while phosphorus undergoes oxidation from +3 to +5 oxidation state. - The balanced equation for this reaction is: K3PO3 + AgNO3 -> KN03 + Ag3PO4.

3) Cu(OH)2 + HNO3 -> Cu(NO3)2 + H2O - This is a redox reaction where copper(II) hydroxide (Cu(OH)2) reacts with nitric acid (HNO3) to form copper(II) nitrate (Cu(NO3)2) and water (H2O). - In this reaction, copper undergoes oxidation from +2 to +2 oxidation state, while nitrogen undergoes reduction from +5 to +2 oxidation state. - The balanced equation for this reaction is: Cu(OH)2 + HNO3 -> Cu(NO3)2 + H2O.

4) FeBr2 + Cl2 -> FeCl3 + Br2 - This is a redox reaction where iron(II) bromide (FeBr2) reacts with chlorine gas (Cl2) to form iron(III) chloride (FeCl3) and bromine gas (Br2). - In this reaction, iron undergoes oxidation from +2 to +3 oxidation state, while chlorine undergoes reduction from 0 to -1 oxidation state. - The balanced equation for this reaction is: FeBr2 + Cl2 -> FeCl3 + Br2.

5) FeSO3 + K2Cr2O7 + H2SO4 -> Fe2(SO4)3 + K2SO4 + Cr(SO4)3 + H2O - This is a redox reaction where iron(II) sulfite (FeSO3) reacts with potassium dichromate (K2Cr2O7) and sulfuric acid (H2SO4) to form iron(III) sulfate (Fe2(SO4)3), potassium sulfate (K2SO4), chromium(III) sulfate (Cr(SO4)3), and water (H2O). - In this reaction, iron undergoes oxidation from +2 to +3 oxidation state, while chromium undergoes reduction from +6 to +3 oxidation state. - The balanced equation for this reaction is: FeSO3 + K2Cr2O7 + H2SO4 -> Fe2(SO4)3 + K2SO4 + Cr(SO4)3 + H2O.

Please let me know if you have any further questions!