Question

Помогите срочно решить!Пожалуйста!!Раствором содержащим 49 г серной кислоты обработали 18 г оксида магния.Масса полученной соли?

Answer 1

H2SO4+MgO=MgSO4+H2O

n(H2SO4)=m(H2SO4)/M(H2SO4)=49г/98г\моль=0.5моль

n(MgO)=m(MgO)/M(MgO)=18г/40г\моль=0.45моль

По уравнению реукции видно, что химические количества раегентов относятся как 1:1, значит кислота взята в избытке и считать нужно по оксиду магния:

n(MgSO4)=0.45моль*1моль/1моль=0.45моль

m(MgSO4)=n(MgSO4)*M(MgSO4)=0.45моль*120г\моль=54г

Answer 2

H2SO4+MgO---->MgSO4+H2O;

n(H2SO4)=49/98=0,5моль(избыток)

n(MgO)=18/40=0,45моль(недостаток)

Расчет ведем по недостатку!

n(MgO)=n(MgSO4)=0,45моль(по ур-ию р-ии)

m(MgSO4)=0,45*120=54г 

 

 

Answer 3

Calculating the Mass of the Salt

To calculate the mass of the salt obtained from the reaction between sulfuric acid and magnesium oxide, we can use the following steps:

1. Balanced Chemical Equation: - The balanced chemical equation for the reaction between sulfuric acid (H2SO4) and magnesium oxide (MgO) is: ``` H2SO4 + MgO → MgSO4 + H2O ```

2. Molar Mass Calculation: - Calculate the molar mass of sulfuric acid (H2SO4) and magnesium oxide (MgO) to determine the stoichiometry of the reaction.

3. Moles of Reactants: - Use the given masses of sulfuric acid and magnesium oxide to calculate the moles of each reactant.

4. Limiting Reactant: - Identify the limiting reactant to determine the amount of salt produced.

5. Calculate the Mass of the Salt: - Use the stoichiometry of the balanced chemical equation to calculate the mass of the salt produced.

Let's proceed with these calculations.

Balanced Chemical Equation

The balanced chemical equation for the reaction between sulfuric acid and magnesium oxide is: ``` H2SO4 + MgO → MgSO4 + H2O ```

Molar Mass Calculation

The molar mass of sulfuric acid (H2SO4) is approximately 98.08 g/mol, and the molar mass of magnesium oxide (MgO) is approximately 40.30 g/mol.

Moles of Reactants

Given: - Mass of sulfuric acid (H2SO4) = 49 g - Mass of magnesium oxide (MgO) = 18 g

Calculating moles: - Moles of H2SO4 = 49 g / 98.08 g/mol ≈ 0.499 moles - Moles of MgO = 18 g / 40.30 g/mol ≈ 0.446 moles

Limiting Reactant

To determine the limiting reactant, we compare the moles of each reactant and identify which one is present in the lower amount. In this case, magnesium oxide (MgO) is the limiting reactant.

Calculate the Mass of the Salt

Using the stoichiometry of the balanced chemical equation, the mass of the salt (MgSO4) produced can be calculated based on the moles of magnesium oxide reacted.

The molar mass of magnesium sulfate (MgSO4) is approximately 120.37 g/mol.

Since magnesium oxide is the limiting reactant, the mass of the salt produced can be calculated as follows: - Moles of MgSO4 = Moles of MgO = 0.446 moles - Mass of MgSO4 = Moles of MgSO4 * Molar mass of MgSO4 = 0.446 moles * 120.37 g/mol ≈ 53.66 g

The mass of the salt obtained from the reaction is approximately 53.66 grams.

I hope this helps! If you have any further questions, feel free to ask.