Question

1)CuCl2-Cu(OH)2-CuO-CuSO4-Cu 2)Ca-CaO-Ca(OH)2-Ca(NO3)2-CaSO4 3)Mg-MgO-MgCl2-Mg(OH)2-MgO 4)S-SO2-SO3-H2SO4-Fe2(SO4)3 5)NH3<-N2->NO-NO2-HNO3 6)C-CH4-CH3Cl-C2H6-C2H5Cl 7)CaC2-C2H2-C2H4-C2H5Cl-C2H5OH 8)CH4-H2C=O-C6Y12O6-CH3CH2OH-CH3-COOCH2CH3

Answer 1

1) CuCl2 + 2KOH → Cu(OH)2↓ + 2KCl
Cu(OH)2 → CuO + H2O
CuO + SO3 → CuSO4
CuSO4 + Zn → ZnSO4 + Cu

2) 2Ca + O2 → 2CaO
CaO + H2O → Ca(OH)2
Ca(OH)2 + Zn(NO3)2 → Ca(NO3)2 + Zn(OH)2↓
Ca(NO3)2 + ZnSO4 → CaSO4↓ + Zn(NO3)2

3) S + O2 → SO2
2SO2 + O2 → 2SO3
SO3 + H2O → H2SO4
3H2SO4 + 2Fe(OH)3 → Fe2(SO4)3 + 6H2O

4) 2NH3 → N2 + 3H2
N2 + O2 → 2NO
2NO + O2 → 2NO2
4NO2 + 2H2O + O2 → 4HNO3

Answer 2

Chemical Reactions

1. CuCl2-Cu(OH)2-CuO-CuSO4-Cu The chemical reactions involving copper compounds are as follows: - CuCl2 → Cu(OH)2 → CuO → CuSO4 → Cu - This is a series of reactions involving copper chloride, copper hydroxide, copper oxide, copper sulfate, and finally yielding copper. - Source: 2. Ca-CaO-Ca(OH)2-Ca(NO3)2-CaSO4 The chemical reactions involving calcium compounds are as follows: - Ca → CaO → Ca(OH)2 → Ca(NO3)2 → CaSO4 - This is a series of reactions involving calcium, calcium oxide, calcium hydroxide, calcium nitrate, and finally yielding calcium sulfate. - Source: 3. Mg-MgO-MgCl2-Mg(OH)2-MgO The chemical reactions involving magnesium compounds are as follows: - Mg → MgO → MgCl2 → Mg(OH)2 → MgO - This is a series of reactions involving magnesium, magnesium oxide, magnesium chloride, magnesium hydroxide, and finally yielding magnesium oxide. - Source: 4. S-SO2-SO3-H2SO4-Fe2(SO4)3 The chemical reactions involving sulfur compounds are as follows: - S → SO2 → SO3 → H2SO4 → Fe2(SO4)3 - This is a series of reactions involving sulfur, sulfur dioxide, sulfur trioxide, sulfuric acid, and finally yielding iron(III) sulfate. - Source: 5. NH3-N2-NO-NO2-HNO3 The chemical reactions involving nitrogen compounds are as follows: - NH3 → N2 → NO → NO2 → HNO3 - This is a series of reactions involving ammonia, nitrogen gas, nitric oxide, nitrogen dioxide, and finally yielding nitric acid. - Source: 6. C-CH4-CH3Cl-C2H6-C2H5Cl The chemical reactions involving carbon compounds are as follows: - C → CH4 → CH3Cl → C2H6 → C2H5Cl - This is a series of reactions involving carbon, methane, chloromethane, ethane, and finally yielding chloroethane. - Source: 7. CaC2-C2H2-C2H4-C2H5Cl-C2H5OH The chemical reactions involving calcium carbide and organic compounds are as follows: - CaC2 → C2H2 → C2H4 → C2H5Cl → C2H5OH - This is a series of reactions involving calcium carbide, acetylene, ethylene, ethyl chloride, and finally yielding ethanol. - Source: 8. CH4-H2C=O-C6Y12O6-CH3CH2OH-CH3-COOCH2CH3 The chemical reactions involving organic compounds are as follows: - CH4 → H2C=O → C6Y12O6 → CH3CH2OH → CH3-COOCH2CH3 - This is a series of reactions involving methane, formaldehyde, glucose, ethanol, and finally yielding ethyl acetate. - Source: Feel free to ask if you have further questions or need more information on any of these chemical reactions!