Question

Закончить уравнение химической реакции , расставить коэффициенты методом электронного баланса , указать окислитель и восстановитель H2SO4 ( конц.)+ Сu -->

Answer 1

Cu(0)+H2S(+6)O4(k)=Cu(+2)SO4+S(+4)O2+H2O
Cu(0)-2e-=Cu(+2)   1- восстановитель
S(+6)+2e-=S(+4)   1 - окислитель
Cu(0)+S(+6)=Cu(+2)+S(+4)
Cu+2H2SO4=CuSO4+SO2+2H2O

Answer 2

Balancing the Chemical Equation: H2SO4 + Cu -> ?

To balance the chemical equation H2SO4 + Cu -> ?, we need to ensure that the number of atoms of each element is the same on both sides of the equation. We can use the method of electron balance to achieve this.

Let's start by balancing the sulfur (S) atoms. There is one sulfur atom on the left side (in H2SO4) and none on the right side. To balance the sulfur atoms, we can add a coefficient of 1 in front of CuSO4 on the right side.

The equation now becomes:

H2SO4 + Cu -> CuSO4 + ?

Next, let's balance the hydrogen (H) atoms. There are two hydrogen atoms on the left side (in H2SO4) and none on the right side. To balance the hydrogen atoms, we can add a coefficient of 2 in front of H2O on the right side.

The equation now becomes:

H2SO4 + Cu -> CuSO4 + 2H2O + ?

Finally, let's balance the oxygen (O) atoms. There are four oxygen atoms on the left side (in H2SO4) and four oxygen atoms on the right side (two in CuSO4 and two in H2O). The oxygen atoms are already balanced.

The balanced equation is:

H2SO4 + Cu -> CuSO4 + 2H2O

In this reaction, H2SO4 (sulfuric acid) is the oxidizing agent (or oxidant) because it causes the copper (Cu) to lose electrons and undergo oxidation. Cu is the reducing agent (or reductant) because it causes the sulfuric acid (H2SO4) to gain electrons and undergo reduction.

I hope this helps! Let me know if you have any further questions.