Question

В схемах хим.реакций расставьте коэф. и укажите тип реакции Fe+HCl=FeCl2+H2 Al+c=al2c3 hgo=hg+o2 ca(oh)2+ hno3=ca(no3)2= h2o fe+cl2=fecl3 al+cuo=cu=al2o2 ch4=c+h2 h3po4+kon=k3po4+h2o

Answer 1

Fe+2HCl=FeCl2+H2(стрелочка вверх) р.замещения
2Al+3C=Al2C3 р.соединения
2HgO=2Hg+O2(стрелочка вверх) р.разложения
Ca(OH)2+2HNO3=Ca(NO3)2+2H2O р.обмена
2Fe+3Cl2=2FeCl3 р.соединения
2Al+3CuO=Al2O3+3Cu р.замещения 
CH4=C+2H2(стрелочка вверх) р.разложения
KOH+H3PO4=KPO4+2H2O р.обмена

Answer 2

Chemical Reactions and Balancing Equations

Let's go through the given chemical reactions and balance the equations while identifying the reaction types.

1. Fe + HCl = FeCl2 + H2 - This is a single replacement reaction. - The balanced equation is: Fe + 2HCl = FeCl2 + H2.

2. Al + C = Al2C3 - This is a synthesis reaction. - The balanced equation is: 2Al + 3C = Al2C3.

3. HgO = Hg + O2 - This is a decomposition reaction. - The balanced equation is: 2HgO = 2Hg + O2.

4. Ca(OH)2 + HNO3 = Ca(NO3)2 + H2O - This is a double displacement reaction. - The balanced equation is: Ca(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O.

5. Fe + Cl2 = FeCl3 - This is a single replacement reaction. - The balanced equation is: 2Fe + 3Cl2 = 2FeCl3.

6. Al + CuO = Cu + Al2O3 - This is a single replacement reaction. - The balanced equation is: 2Al + 3CuO = 3Cu + Al2O3.

7. CH4 = C + 2H2 - This is a decomposition reaction. - The balanced equation is: CH4 = C + 2H2.

8. H3PO4 + KOH = K3PO4 + H2O - This is a double displacement reaction. - The balanced equation is: 3H3PO4 + 3KOH = K3PO4 + 3H2O.

Please note that the search results did not provide specific information for the given reactions. However, the balanced equations provided above are based on the general rules of chemical reactions and balancing equations.