Question

NH3=(NH4)2SO4=NH4Cl=NH4NO3=NH3=

Answer 1

2NH3 + H2SO4 = (NH4)2SO4

(NH4)2SO4 + BaCl2 = BaSO4 + 2NH4Cl

NH4Cl + AgNO3 = NH4NO3 + AgCl

NH4NO3 + KOH = KNO3 + H2O + NH3

Answer 2

It seems like you have written a chemical equation, but it's not balanced. Chemical equations need to be balanced to accurately represent a chemical reaction. Additionally, it's not clear what the reaction is meant to be. Let me provide some clarity and balance the equation based on potential assumptions:

Let's assume the reaction is the decomposition of ammonium sulfate ((NH4)2SO4) into ammonia (NH3), ammonium chloride (NH4Cl), and ammonium nitrate (NH4NO3):

(NH4)2SO4 → NH3 + NH4Cl + NH4NO3

Now, to balance the equation, we need to ensure that the same number of atoms of each element is present on both sides of the equation. The balanced equation would be:

(NH4)2SO4 → 2NH3 + NH4Cl + NH4NO3

This balanced equation represents the decomposition of ammonium sulfate into ammonia, ammonium chloride, and ammonium nitrate.