Question

Fe-Fe2O3-Fecl3-Fe2(SO4)-Fe(NO3)2-Fe(OH)3-Fe2O3-Fe

Answer 1

Ответ:

2Fe+3Cl2=2FeCl3

FeCl3+3NaOH=3NaCl+Fe(OH)3

2Fe(OH)3=Fe2O3+3H2O

Fe2O3+3H2So4=Fe2(SO4)3+3H2O

Fe2(SO4)3+3Ba(No3)2=3BaSO4+2Fe(NO3)3

Объяснение:

Answer 2

It seems like you've listed a series of chemical compounds involving iron (Fe) in different oxidation states and with various ligands. Let's break down each compound:

1. Fe: This simply represents elemental iron, which has zero oxidation state.

2. Fe2O3: This is iron(III) oxide, also known as rust, where iron is in the +3 oxidation state.

3. FeCl3: This is iron(III) chloride, where iron is again in the +3 oxidation state.

4. Fe2(SO4)3: This is iron(III) sulfate, where iron is in the +3 oxidation state.

5. Fe(NO3)2: This is iron(II) nitrate, where iron is in the +2 oxidation state.

6. Fe(OH)3: This is iron(III) hydroxide, where iron is in the +3 oxidation state.

7. Fe2O3: This is iron(III) oxide again, with the same oxidation state as in the first instance.

8. Fe: This is elemental iron, once more representing zero oxidation state.

In summary, the compounds listed include various forms of iron with different oxidation states and ligands, ranging from elemental iron to iron in the +2 and +3 oxidation states, as well as combined with different anions like chloride, sulfate, nitrate, and hydroxide.