Question

Fe(OH)2+HNO3=Fe(NO3)2+H20

Answer 1

Ответ:

Это кислотно-щелочная реакция (нейтрализа́ция): Fe(OH)2 является щелочным, HNO3 представляет собой кислоту.

Объяснение:

Fe(OH)2

Названия: Гидроксид железа(II) источник:

HNO3 – Азотная кислота источник:

Другие названия: Селитряная кислота HNO3

Внешность (состояние): Жидкость. От бесцветной до жёлтого цвета жидкость с резким запахом

Answer 2

The chemical equation you've provided is not balanced. To balance it, you need to ensure that there are an equal number of each type of atom on both sides of the equation. Here's the balanced chemical equation for the reaction between iron(II) hydroxide (Fe(OH)2) and nitric acid (HNO3) to produce iron(II) nitrate (Fe(NO3)2) and water (H2O):

2Fe(OH)2 + 6HNO3 → 2Fe(NO3)2 + 6H2O

Now, the equation is balanced. It shows that two moles of iron(II) hydroxide react with six moles of nitric acid to produce two moles of iron(II) nitrate and six moles of water.