Question

Ca3(Po4)2-P-PCI3-H3PO4-K3PO4-Fe3(PO4)2

Answer 1

Ответ:

2Ca3(PO4)2 + 6SiO2 + 10C → 6CaSiO3 + P4 + 10CO

2P + 3Cl2 → 2PCl3

2HNO3 + PCl3 + 2H2O → 2NO2 + H3PO4 + 3HCl

3KOH + H3PO4 → K3PO4 + 3H2O  

3Fe(NO3)2 + 2K3PO4 → Fe3(PO4)2 + 6KNO3

Объяснение:

Answer 2

It seems like you've provided a list of chemical compounds and elements. I can help provide information about each of them:

1. Ca3(PO4)2 - This is calcium phosphate, a chemical compound that is commonly found in rocks and is a major component of tooth enamel and bone.

2. P - This represents the element phosphorus, which is a non-metal element that plays a crucial role in biological systems and is used in various industrial applications.

3. PCl3 - This is phosphorus trichloride, a chemical compound composed of phosphorus and chlorine atoms. It is a colorless and toxic liquid that is used in the synthesis of various organic compounds.

4. H3PO4 - This is phosphoric acid, a strong mineral acid used in a variety of applications, including as a food additive, rust inhibitor, and in the production of fertilizers.

5. K3PO4 - This is potassium phosphate, a salt that contains potassium ions and phosphate ions. It can be used in buffer solutions and as a fertilizer.

6. Fe3(PO4)2 - This is iron(II) phosphate, a chemical compound composed of iron and phosphate ions. It can be used as a pigment, in the synthesis of ceramics, and in some industrial processes.

If you have specific questions about any of these compounds or elements or if you need more detailed information, please feel free to ask.