Question

Осуществлите цепочку реакцийP-Ca3P2-PH3-P2O5-Ca3(PO4)2-H3PO4​

Answer 1

Ответ:

1) 2P + 3Ca → Ca3P2

2) 6H2O + Ca3P2 → 3Ca(OH)2 + 2PH3

3) 4O2 + 2PH3 → 3 H2O + P2O5

4) 3H2O + P2O5 → 2H3PO4

5) 3Ca(OH)2 + 2H3PO4 → 6H2O + Ca3(PO4)2

Answer 2

Reaction Chain: P-Ca3P2-PH3-P2O5-Ca3(PO4)2-H3PO4

The reaction chain you provided involves several chemical reactions. Let's break it down step by step:

1. P (Phosphorus) reacts with Ca3P2 (Calcium Phosphide): - The reaction between phosphorus and calcium phosphide is not specified in the search results.

2. Ca3P2 (Calcium Phosphide) reacts to form PH3 (Phosphine): - The reaction between calcium phosphide and phosphine is not specified in the search results.

3. PH3 (Phosphine) reacts with P2O5 (Diphosphorus Pentoxide): - The reaction between phosphine and diphosphorus pentoxide is not specified in the search results.

4. P2O5 (Diphosphorus Pentoxide) reacts to form Ca3(PO4)2 (Calcium Phosphate): - According to the search result diphosphorus pentoxide reacts with water to form phosphoric acid (H3PO4), not calcium phosphate.

5. Ca3(PO4)2 (Calcium Phosphate) reacts to form H3PO4 (Phosphoric Acid): - The reaction between calcium phosphate and phosphoric acid is not specified in the search results.

Therefore, based on the available search results, the specific reactions in the given chain are not provided. If you have any additional information or specific reactions you would like to know about, please let me know, and I'll do my best to assist you further.