Question

Sn-SnO-Sn(NO3)2-Sn(OH)2-Na2SnO2-SnSO4

Answer 1

Ответ:

Sn → SnO → Sn(NO3)2 → Sn(OH)2 → Na2SnO2 → SnSO4

2 Sn+O2 → 2 SnO

SnO+2 HNO3 → Sn(NO3)2 + H2O

Sn(NO3)2 + 2 NaOH → Sn(OH)2 + 2 NaNO3

Sn(OH)2 + 2 NaOH → Na2SnO2 + 2 H2O

Na2SnO2+H2SO4  → SnSO4+Na2O + H2O

Answer 2

The sequence you provided represents a series of chemical reactions involving tin (Sn) and various compounds. Let's go through each compound and its corresponding reaction:

1. Sn: This represents elemental tin. It is the starting material for the reactions.

2. SnO: This represents tin(II) oxide, also known as stannous oxide. It is formed when tin reacts with oxygen.

   Sn + 0.5O2 -> SnO

3. Sn(NO3)2: This represents tin(II) nitrate. It is formed when tin reacts with nitric acid (HNO3).

   Sn + 4HNO3 -> Sn(NO3)2 + 2H2O + 2NO2

4. Sn(OH)2: This represents tin(II) hydroxide. It is formed when tin(II) nitrate reacts with a base, such as sodium hydroxide (NaOH).

   Sn(NO3)2 + 2NaOH -> Sn(OH)2 + 2NaNO3

5. Na2SnO2: This represents sodium stannate. It is formed when tin(II) hydroxide reacts with sodium hydroxide.

   Sn(OH)2 + 2NaOH -> Na2SnO2 + 2H2O

6. SnSO4: This represents tin(II) sulfate. It is formed when tin reacts with sulfuric acid (H2SO4).

   Sn + H2SO4 -> SnSO4 + H2

Please note that the reactions provided are simplified representations and may not account for specific reaction conditions or stoichiometry. Also, in some cases, the actual products formed may vary depending on the reaction conditions and concentrations of the reactants.