Question

M=2,552•29=74 CnH2nO2M(CnH2nO2)=12n+2n+3214n+32=7414n=42n=3жауабы: D. C3H6O2​

Answer 1

Дано:m(кислоты)=7,4г.
V(KOH)=520мл
w(KOH)=50%
p =1,4 г/мл
Найти CnH2nO2

Решение

CnH2nO2 + KOH -> CnH2n-1OОK + H2O

Найдем m в-ва(KOH )= w * m р-ра =w * V * p = 0.50*520мл*1,4г/мл = 364г

Значит ,n (KOH ) = 364г / 56 г/моль=6,5 моль

*M(KOH) = 39 + 16+ 1 = 56 г/моль

Из уравнения - n (KOH )=n ( CnH2nO2)= 6,5 моль

M(CnH2nO2) = 12n+ 2 n +32 = 14n+32 моль

n ( CnH2nO2)=:m( CnH2nO2)/M(CnH2nO2)

6,5=7,4 / 14n+32
14n+32 = 7,4/6,5
14n+32 = 1,14
14n=30,86
n= 2

Значит , C2H4O2 - уксусная кислота

Answer 2

The equation you provided is incorrect. Let's break it down and correct it:

M = 2,552 • 29

To find the value of M, we need to multiply 2,552 by 29:

M = 74,008

Now, you mentioned CnH2nO2M. This indicates a chemical formula with carbon, hydrogen, oxygen, and an unknown value for n. We can now set up an equation based on the molecular formula:

CnH2nO2 = 12n + 2n + 32

Since we know M = 74,008, we can substitute it into the equation:

74,008 = 12n + 2n + 32

Combining like terms:

74,008 = 14n + 32

Subtracting 32 from both sides:

73,976 = 14n

Now, we can solve for n by dividing both sides by 14:

n = 73,976 / 14

n ≈ 5,284

So the corrected molecular formula is C5H10O2.