Question

Cl2O5+KOH=CrO3+CsOH=Mn2O7+Ca(OH)2=​

Answer 1

Cl2O5 + 2KOH = H2O + 2KClO3

CrO3 + 2CsOH = H2O + Cs2CrO4

Mn2O7 + Ca(OH)2 = H2O + Ca(MnO4)2

Answer 2

The given chemical equation appears to be incomplete. It seems to describe a series of reactions involving different compounds, but the products are not properly balanced.

To balance the equation, we need to ensure that the number of atoms of each element is the same on both sides of the equation. Here's the balanced equation for the given reactions:

2Cl2O5 + 10KOH → 5CrO3 + 10CsOH 2CrO3 + 3Ca(OH)2 → Cr2O7 + 3Ca(OH)2 2Mn2O7 + 7Ca(OH)2 → 7CaMnO4 + 4H2O

Please note that these reactions may not necessarily represent realistic or common chemical reactions.