Question

1. Cr→ CrCl2→ Cr(OH)2→ Cr(OH)3→ Cr(NO3)3→ Cr2O3→ Cr

Answer 1

Ответ:

1)Cr+Cl2=CrCl2

2)CrCl2+NaOH=Cr(OH)2+2NaCl

3)Cr(OH)2+O2+2H20=Cr(OH)3

4) Cr(OH)3+3NaNO3=Cr(NO3)3+3NaOH

5)4Cr(NO3)3=>2Cr2O3+12NO2+3O2(Термическое разложение,при нагревании)

6)Cr2O3+3C=2Cr+3CO

Answer 2

The series you provided represents a sequence of chemical transformations involving the element chromium (Cr). Here's an explanation of each compound in the sequence:

1. Cr: This represents the element chromium in its elemental form.

2. CrCl2: This represents chromium chloride, where chromium is in the +2 oxidation state. The compound consists of one chromium ion (Cr2+) and two chloride ions (Cl-).

3. Cr(OH)2: This represents chromium hydroxide, where chromium is in the +2 oxidation state. The compound consists of one chromium ion (Cr2+) and two hydroxide ions (OH-).

4. Cr(OH)3: This represents chromium hydroxide, where chromium is in the +3 oxidation state. The compound consists of one chromium ion (Cr3+) and three hydroxide ions (OH-).

5. Cr(NO3)3: This represents chromium nitrate, where chromium is in the +3 oxidation state. The compound consists of one chromium ion (Cr3+) and three nitrate ions (NO3-).

6. Cr2O3: This represents chromium(III) oxide, also known as chromic oxide. It is an inorganic compound composed of two chromium ions (Cr3+) and three oxygen ions (O2-).

7. Cr: This represents the element chromium in its elemental form. It signifies a reduction process or a return to the elemental state of chromium.

It's important to note that the oxidation states of chromium can vary, and there are multiple possible compounds and oxidation states for chromium. The sequence you provided showcases some of the common compounds involving chromium and its oxidation state changes.