Question

1)  Hno3 →cu(no3)2 →hno3 →Agno3 →AgCE   2) HNO3+CUCE2 →CU(NO3)2+AHCE 3) CU(NO3)2+H2SO4 →CUSO4+HNO3 4) 2HNO3+Ag →Ag →Agno3+no2 ↑ +2h2o 5) Agno3+nace  → Agce+nano3           

Answer 1

Cu+4HNO3=Cu(NO3)2+2NO2+2H2O 
Cu(0)-2e=Cu(+2) 
N(+5)+1e=N(+4)*2 
Ag+2HNO3=AgNO3+NO2+H2O 
Ag(0)-1e=Ag(+1) 
N(+5)+1e=N(+4)

Answer 2

Here is a breakdown of the chemical reactions you provided:

1. HNO3 → Cu(NO3)2 → HNO3 → AgNO3 → AgCE This series of reactions involves the following steps:

• Nitric acid (HNO3) reacts with copper (Cu) to form copper(II) nitrate (Cu(NO3)2).
• The resulting copper(II) nitrate is then reacted with more nitric acid (HNO3).
• Next, silver nitrate (AgNO3) is formed by reacting the product from the previous step with nitric acid (HNO3).
• Finally, the silver nitrate reacts with an unknown compound or element to produce silver on the cathode electrode (AgCE).

2. HNO3 + CUCE2 → CU(NO3)2 + AHCE In this equation, it appears that nitric acid (HNO3) reacts with an unknown compound or element (CUCE2) to form copper(II) nitrate (CU(NO3)2) and another unknown compound (AHCE).

3. CU(NO3)2 + H2SO4 → CUSO4 + HNO3 This reaction involves the reaction between copper(II) nitrate (CU(NO3)2) and sulfuric acid (H2SO4), resulting in the formation of copper(II) sulfate (CUSO4) and nitric acid (HNO3).

4. 2HNO3 + Ag → Ag → AgNO3 + NO2 ↑ + 2H2O In this equation, two molecules of nitric acid (HNO3) react with silver (Ag) to produce silver, which further reacts with nitric acid to form silver nitrate (AgNO3). Additionally, nitrogen dioxide gas (NO2) is released, and water (H2O) is formed.

5. AgNO3 + NACE → AgCE + NaNO3 This reaction involves the reaction between silver nitrate (AgNO3) and an unknown compound or element (NACE) to form silver on the cathode electrode (AgCE) and sodium nitrate (NaNO3).

Please note that some of the reactions you provided are incomplete or have missing information about the unknown compounds or elements involved.