Question

Cr2(So4)3--Cr(oh)3--Cr2(So4)3--BaSo4

Answer 1

Ответ:

1) 2Cr(OH)3 + 3H2SO4 = Cr2(SO4)3 + 6H2O  

2) Cr2(SO4)3 + 6KOH = 2Cr(OH)3 + 3K2SO4  

3) 2Cr(OH)3 + 3Cl2 + 10LiOH = 2LI2CrO3 + 6LiCl + 8H2O

Объяснение:

Answer 2

The chemical equation you provided seems to depict a series of reactions involving chromium (Cr) and sulfate (SO4) ions. Let's break it down step by step:

1. Cr2(SO4)3: This is the chemical formula for chromium(III) sulfate. It indicates that each chromium ion (Cr3+) is surrounded by three sulfate ions (SO4^2-).

2. Cr(OH)3: This formula represents chromium(III) hydroxide. It shows that each chromium ion (Cr3+) is bonded to three hydroxide ions (OH^-).

3. Cr2(SO4)3: This is the same compound mentioned in step 1, chromium(III) sulfate. It suggests that the reaction has returned to the starting point.

4. BaSO4: This formula represents barium sulfate, which is formed by the reaction between barium ions (Ba^2+) and sulfate ions (SO4^2-).

Based on the given information, it appears that chromium(III) sulfate (Cr2(SO4)3) undergoes a reaction to form chromium(III) hydroxide (Cr(OH)3). However, the subsequent step returns to chromium(III) sulfate (Cr2(SO4)3). It is unclear how barium sulfate (BaSO4) relates to the series of reactions you provided.