Question

Составить уравнения реакций для цепочки превращений N2-NH3-NO-NO2-HNO3-Ba(NO3)2

Answer 1

N2 +3 H2 = 2NH3

4NH3 +5O2 = 4NO + 6H2O

2NO + O2 =2 NO2

2NO2 + H2O = HNO3 + HNO2

2HNO3 + BaO = Ba(NO3)2 + H2O

Answer 2

Chemical Reactions for the Transformation N2-NH3-NO-NO2-HNO3-Ba(NO3)2

The transformation of N2 to Ba(NO3)2 involves several chemical reactions. Here is a step-by-step breakdown of the reactions involved:

1. N2 to NH3: - The reaction is represented as: N2 + 3H2 → 2NH3.

2. NH3 to NO: - The reaction is represented as: 4NH3 + 5O2 → 4NO + 6H2O.

3. NO to NO2: - The reaction is represented as: 2NO + O2 → 2NO2.

4. NO2 to HNO3: - The reaction is represented as: 4NO2 + O2 + 2H2O → 4HNO3.

5. HNO3 to Ba(NO3)2: - The reaction is not explicitly mentioned in the search results.

Please note that the search results do not provide a direct reaction for the conversion of HNO3 to Ba(NO3)2. It is possible that this transformation involves additional steps or reactions that are not mentioned in the search snippets provided.

If you require further information or clarification on the specific reaction from HNO3 to Ba(NO3)2, please let me know, and I'll be happy to assist you further.