Вопрос задан 09.05.2019 в 23:02. Предмет Химия. Спрашивает Александрин Богдан.

Составьте структурную формулу алканов: 4,4-диэтилгептан Н.нонан 3-метил-4-пропилдекан

0 0
Перейти к ответам

Ответы на вопрос

Внимание! Ответы на вопросы дают живые люди. Они могут содержать ошибочную информацию, заблуждения, а также ответы могут быть сгенерированы нейросетями. Будьте внимательны. Если вы уверены, что ответ неверный, нажмите кнопку "Пожаловаться" под ответом.
Отвечает Буздалин Игорь.
H3C–CH2–CH2–(C2H5)C(C2H5)–CH2–CH2–CH3
H3C–CH2–CH2–CH2–CH2–CH2–CH2–CH2–CH3
H3C–CH2–CH(CH3)–CH(C3H7)–CH2–CH2–CH2–CH2–CH2–CH3
0 0
Отвечает нейросеть ChatGpt. Будьте внимательны, ответы нейросети могут содержать ошибочные или выдуманные данные.

Structural Formula of 4,4-Diethylheptane:

The structural formula of 4,4-diethylheptane can be represented as follows:

``` CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH3 | | CH3 CH3 ```

This formula indicates that the molecule consists of a chain of seven carbon atoms (heptane) with two ethyl groups (CH3-CH2-) attached to the fourth carbon atom from both ends.

Structural Formula of N.Nonane:

The structural formula of n-nonane can be represented as follows:

``` CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3 ```

This formula indicates that the molecule consists of a chain of nine carbon atoms (nonane) with methyl groups (CH3) attached to both ends.

Structural Formula of 3-Methyl-4-Propyldecane:

The structural formula of 3-methyl-4-propyldecane can be represented as follows:

``` CH3-CH2-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH3 | CH2-CH2-CH3 ```

This formula indicates that the molecule consists of a chain of twelve carbon atoms (decane) with a methyl group (CH3) attached to the third carbon atom and a propyl group (CH2-CH2-CH3) attached to the fourth carbon atom.

I hope this helps! Let me know if you have any further questions.

0 0

Топ вопросов за вчера в категории Химия

Последние заданные вопросы в категории Химия

Задать вопрос