Question

Решительно уравнение реакции: CaCo3+HNO3=Ca(NO3)2+H2O+CO2. Fe2O3+Al=Fe+Al2O3

Answer 1

CaCO3+2HNO3=Ca(NO3)2+H2O+CO2
Fe2O3+2Al=2Fe+Al2O3

Answer 2

Equation 1: CaCO3 + HNO3 = Ca(NO3)2 + H2O + CO2

The given equation represents the reaction between calcium carbonate (CaCO3) and nitric acid (HNO3), resulting in the formation of calcium nitrate (Ca(NO3)2), water (H2O), and carbon dioxide (CO2).

To balance the equation, we need to ensure that the number of atoms of each element is the same on both sides of the equation.

The balanced equation for the reaction is as follows:

CaCO3 + 2HNO3 = Ca(NO3)2 + H2O + CO2.

Equation 2: Fe2O3 + Al = Fe + Al2O3

The given equation represents the reaction between iron(III) oxide (Fe2O3) and aluminum (Al), resulting in the formation of iron (Fe) and aluminum oxide (Al2O3).

To balance the equation, we need to ensure that the number of atoms of each element is the same on both sides of the equation.

The balanced equation for the reaction is as follows:

2Fe2O3 + 4Al = 6Fe + 2Al2O3.

Please let me know if there's anything else I can help you with!